C27H32N10O4 — CID 118632067
tert-butyl 4-[4-[4-[[2-[(1-methylpyrazol-4-yl)amino]-5-nitropyrimidin-4-yl]amino]phenyl]pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 118632067) has the molecular formula C27H32N10O4 and a molecular weight of 560.62 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-[[2-[(1-methylpyrazol-4-yl)amino]-5-nitropyrimidin-4-yl]amino]phenyl]pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[4-[[2-[(1-methylpyrazol-4-yl)amino]-5-nitropyrimidin-4-yl]amino]phenyl]pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118632067 |
| Molecular Formula | C27H32N10O4 |
| Molecular Weight | 560.62 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | tert-butyl 4-[4-[4-[[2-[(1-methylpyrazol-4-yl)amino]-5-nitropyrimidin-4-yl]amino]phenyl]pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | Cn1cc(Nc2ncc([N+](=O)[O-])c(Nc3ccc(-c4cnn(C5CCN(C(=O)OC(C)(C)C)CC5)c4)cc3)n2)cn1 |
| InChI | InChI=1S/C27H32N10O4/c1-27(2,3)41-26(38)35-11-9-22(10-12-35)36-16-19(13-30-36)18-5-7-20(8-6-18)31-24-23(37(39)40)15-28-25(33-24)32-21-14-29-34(4)17-21/h5-8,13-17,22H,9-12H2,1-4H3,(H2,28,31,32,33) |
| InChIKey | XFECMXQIQGWUTQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 158.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.62 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|