About 1,5-diiodocyclotridecane
1,5-diiodocyclotridecane (PubChem CID 118632110) has the molecular formula C13H24I2
and a molecular weight of 434.14 g/mol. Its IUPAC name is 1,5-diiodocyclotridecane.
Molecular Properties
| Compound Name | 1,5-diiodocyclotridecane |
| PubChem CID | 118632110 |
| Molecular Formula | C13H24I2 |
| Molecular Weight | 434.14 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | 1,5-diiodocyclotridecane |
| SMILES | IC1CCCCCCCCC(I)CCC1 |
| InChI | InChI=1S/C13H24I2/c14-12-8-5-3-1-2-4-6-9-13(15)11-7-10-12/h12-13H,1-11H2 |
| InChIKey | QFMJBJFEDPAJSL-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.14 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,5-diiodocyclotridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-diiodocyclotridecane?
The IUPAC name of 1,5-diiodocyclotridecane (CID 118632110) is 1,5-diiodocyclotridecane.
What is the SMILES notation for 1,5-diiodocyclotridecane?
The canonical SMILES for 1,5-diiodocyclotridecane is IC1CCCCCCCCC(I)CCC1.
What is the InChIKey of 1,5-diiodocyclotridecane?
The InChIKey is QFMJBJFEDPAJSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24I2/c14-12-8-5-3-1-2-4-6-9-13(15)11-7-10-12/h12-13H,1-11H2.
What are the key properties of 1,5-diiodocyclotridecane?
1,5-diiodocyclotridecane has a molecular weight of 434.14 g/mol, XLogP of 5.90, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diiodocyclotridecane is sourced from PubChem (CID 118632110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).