C18H18ClF3N6O — CID 118632585
3-N-[3-chloro-4-[4-[2-(methylamino)ethoxy]phenyl]-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-3,5-diamine (PubChem CID 118632585) has the molecular formula C18H18ClF3N6O and a molecular weight of 426.83 g/mol. Its IUPAC name is 3-N-[3-chloro-4-[4-[2-(methylamino)ethoxy]phenyl]-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[3-chloro-4-[4-[2-(methylamino)ethoxy]phenyl]-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 118632585 |
| Molecular Formula | C18H18ClF3N6O |
| Molecular Weight | 426.83 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 3-N-[3-chloro-4-[4-[2-(methylamino)ethoxy]phenyl]-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-3,5-diamine |
| SMILES | CNCCOc1ccc(-c2c(Cl)cc(Nc3n[nH]c(N)n3)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H18ClF3N6O/c1-24-6-7-29-12-4-2-10(3-5-12)15-13(18(20,21)22)8-11(9-14(15)19)25-17-26-16(23)27-28-17/h2-5,8-9,24H,6-7H2,1H3,(H4,23,25,26,27,28) |
| InChIKey | DKJQYDAQPAUGNH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.83 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|