C20H35N4O6PS — CID 118632622
O-[(2R,3S,5R)-5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxy-2-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-3-yl] N-methoxy-N-methylcarbamothioate (PubChem CID 118632622) has the molecular formula C20H35N4O6PS and a molecular weight of 491.57 g/mol. Its IUPAC name is O-[(2R,3S,5R)-5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxy-2-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-3-yl] N-methoxy-N-methylcarbamothioate.
| Compound Name | O-[(2R,3S,5R)-5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxy-2-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-3-yl] N-methoxy-N-methylcarbamothioate |
|---|---|
| PubChem CID | 118632622 |
| Molecular Formula | C20H35N4O6PS |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | O-[(2R,3S,5R)-5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxy-2-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-3-yl] N-methoxy-N-methylcarbamothioate |
| SMILES | [2H]C[C@H]1O[C@@H](N2C=CC(=O)NC2=C)[C@@H](OC(=S)N(C)OC)C1OP(OC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C20H35N4O6PS/c1-12(2)24(13(3)4)31(27-9)30-17-14(5)28-19(18(17)29-20(32)22(7)26-8)23-11-10-16(25)21-15(23)6/h10-14,17-19H,6H2,1-5,7-9H3,(H,21,25)/t14-,17?,18+,19-,31?/m1/s1/i5D |
| InChIKey | HDBQNFRUFYXMCM-OQXHMJBASA-N |
| XLogP | 2.69 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|