About tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid
tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid (PubChem CID 118632672) has the molecular formula C11H12O2
and a molecular weight of 176.22 g/mol. Its IUPAC name is tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid.
Molecular Properties
| Compound Name | tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid |
| PubChem CID | 118632672 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid |
| SMILES | O=C(O)C1=CC2C3C=CC(C3)C2C1 |
| InChI | InChI=1S/C11H12O2/c12-11(13)8-4-9-6-1-2-7(3-6)10(9)5-8/h1-2,4,6-7,9-10H,3,5H2,(H,12,13) |
| InChIKey | GSGDBVFFMYVAIM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid?
The IUPAC name of tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid (CID 118632672) is tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid.
What is the SMILES notation for tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid?
The canonical SMILES for tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid is O=C(O)C1=CC2C3C=CC(C3)C2C1.
What is the InChIKey of tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid?
The InChIKey is GSGDBVFFMYVAIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c12-11(13)8-4-9-6-1-2-7(3-6)10(9)5-8/h1-2,4,6-7,9-10H,3,5H2,(H,12,13).
What are the key properties of tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid?
tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid has a molecular weight of 176.22 g/mol, XLogP of 1.84, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylic acid is sourced from PubChem (CID 118632672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).