C8H10FN — CID 118633833
4-fluoro-2,3,5,7a-tetrahydro-1H-indole (PubChem CID 118633833) has the molecular formula C8H10FN and a molecular weight of 139.17 g/mol. Its IUPAC name is 4-fluoro-2,3,5,7a-tetrahydro-1H-indole.
| Compound Name | 4-fluoro-2,3,5,7a-tetrahydro-1H-indole |
|---|---|
| PubChem CID | 118633833 |
| Molecular Formula | C8H10FN |
| Molecular Weight | 139.17 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | 4-fluoro-2,3,5,7a-tetrahydro-1H-indole |
| SMILES | FC1=C2CCNC2C=CC1 |
| InChI | InChI=1S/C8H10FN/c9-7-2-1-3-8-6(7)4-5-10-8/h1,3,8,10H,2,4-5H2 |
| InChIKey | QJIVBCIVHAQPOS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.17 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|