About 1-tert-butyl-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene
1-tert-butyl-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene (PubChem CID 118633944) has the molecular formula C14H19F3O2S
and a molecular weight of 308.37 g/mol. Its IUPAC name is 1-tert-butyl-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene.
Molecular Properties
| Compound Name | 1-tert-butyl-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene |
| PubChem CID | 118633944 |
| Molecular Formula | C14H19F3O2S |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-tert-butyl-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene |
| SMILES | CC(C)(C)c1ccc(CS(=O)(=O)CCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H19F3O2S/c1-13(2,3)12-6-4-11(5-7-12)10-20(18,19)9-8-14(15,16)17/h4-7H,8-10H2,1-3H3 |
| InChIKey | HCRUHAZANZXBJI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene?
The IUPAC name of 1-tert-butyl-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene (CID 118633944) is 1-tert-butyl-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene.
What is the SMILES notation for 1-tert-butyl-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene?
The canonical SMILES for 1-tert-butyl-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene is CC(C)(C)c1ccc(CS(=O)(=O)CCC(F)(F)F)cc1.
What is the InChIKey of 1-tert-butyl-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene?
The InChIKey is HCRUHAZANZXBJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F3O2S/c1-13(2,3)12-6-4-11(5-7-12)10-20(18,19)9-8-14(15,16)17/h4-7H,8-10H2,1-3H3.
What are the key properties of 1-tert-butyl-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene?
1-tert-butyl-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene has a molecular weight of 308.37 g/mol, XLogP of 3.85, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-(3,3,3-trifluoropropylsulfonylmethyl)benzene is sourced from PubChem (CID 118633944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).