C15H30O6 — CID 118634410
2-[2-[1-[2-(4-ethenoxybutoxy)ethoxy]propan-2-yloxy]ethoxy]ethanol (PubChem CID 118634410) has the molecular formula C15H30O6 and a molecular weight of 306.40 g/mol. Its IUPAC name is 2-[2-[1-[2-(4-ethenoxybutoxy)ethoxy]propan-2-yloxy]ethoxy]ethanol.
| Compound Name | 2-[2-[1-[2-(4-ethenoxybutoxy)ethoxy]propan-2-yloxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 118634410 |
| Molecular Formula | C15H30O6 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 2-[2-[1-[2-(4-ethenoxybutoxy)ethoxy]propan-2-yloxy]ethoxy]ethanol |
| SMILES | C=COCCCCOCCOCC(C)OCCOCCO |
| InChI | InChI=1S/C15H30O6/c1-3-17-7-4-5-8-18-10-11-20-14-15(2)21-13-12-19-9-6-16/h3,15-16H,1,4-14H2,2H3 |
| InChIKey | KMLAHMFUPVRXEL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|