About [(1S,2S)-2-isocyanatocyclohexyl]oxymethylbenzene
[(1S,2S)-2-isocyanatocyclohexyl]oxymethylbenzene (PubChem CID 11863574) has the molecular formula C14H17NO2
and a molecular weight of 231.30 g/mol. Its IUPAC name is [(1S,2S)-2-isocyanatocyclohexyl]oxymethylbenzene.
Molecular Properties
| Compound Name | [(1S,2S)-2-isocyanatocyclohexyl]oxymethylbenzene |
| PubChem CID | 11863574 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | [(1S,2S)-2-isocyanatocyclohexyl]oxymethylbenzene |
| SMILES | O=C=N[C@H]1CCCC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C14H17NO2/c16-11-15-13-8-4-5-9-14(13)17-10-12-6-2-1-3-7-12/h1-3,6-7,13-14H,4-5,8-10H2/t13-,14-/m0/s1 |
| InChIKey | HWVZRVVQFLEXHN-KBPBESRZSA-N |
| XLogP | 2.85 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2S)-2-isocyanatocyclohexyl]oxymethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-isocyanatocyclohexyl]oxymethylbenzene?
The IUPAC name of [(1S,2S)-2-isocyanatocyclohexyl]oxymethylbenzene (CID 11863574) is [(1S,2S)-2-isocyanatocyclohexyl]oxymethylbenzene.
What is the SMILES notation for [(1S,2S)-2-isocyanatocyclohexyl]oxymethylbenzene?
The canonical SMILES for [(1S,2S)-2-isocyanatocyclohexyl]oxymethylbenzene is O=C=N[C@H]1CCCC[C@@H]1OCc1ccccc1.
What is the InChIKey of [(1S,2S)-2-isocyanatocyclohexyl]oxymethylbenzene?
The InChIKey is HWVZRVVQFLEXHN-KBPBESRZSA-N. The full InChI is InChI=1S/C14H17NO2/c16-11-15-13-8-4-5-9-14(13)17-10-12-6-2-1-3-7-12/h1-3,6-7,13-14H,4-5,8-10H2/t13-,14-/m0/s1.
What are the key properties of [(1S,2S)-2-isocyanatocyclohexyl]oxymethylbenzene?
[(1S,2S)-2-isocyanatocyclohexyl]oxymethylbenzene has a molecular weight of 231.30 g/mol, XLogP of 2.85, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-isocyanatocyclohexyl]oxymethylbenzene is sourced from PubChem (CID 11863574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).