C27H24N6O2 — CID 118635903
(E)-2-[(3R)-3-[[4-(4-methylphenoxy)-1H-pyrazolo[3,4-b]pyridin-3-yl]amino]pyrrolidine-1-carbonyl]-3-phenylprop-2-enenitrile (PubChem CID 118635903) has the molecular formula C27H24N6O2 and a molecular weight of 464.53 g/mol. Its IUPAC name is (E)-2-[(3R)-3-[[4-(4-methylphenoxy)-1H-pyrazolo[3,4-b]pyridin-3-yl]amino]pyrrolidine-1-carbonyl]-3-phenylprop-2-enenitrile.
| Compound Name | (E)-2-[(3R)-3-[[4-(4-methylphenoxy)-1H-pyrazolo[3,4-b]pyridin-3-yl]amino]pyrrolidine-1-carbonyl]-3-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 118635903 |
| Molecular Formula | C27H24N6O2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | (E)-2-[(3R)-3-[[4-(4-methylphenoxy)-1H-pyrazolo[3,4-b]pyridin-3-yl]amino]pyrrolidine-1-carbonyl]-3-phenylprop-2-enenitrile |
| SMILES | Cc1ccc(Oc2ccnc3[nH]nc(N[C@@H]4CCN(C(=O)/C(C#N)=C/c5ccccc5)C4)c23)cc1 |
| InChI | InChI=1S/C27H24N6O2/c1-18-7-9-22(10-8-18)35-23-11-13-29-25-24(23)26(32-31-25)30-21-12-14-33(17-21)27(34)20(16-28)15-19-5-3-2-4-6-19/h2-11,13,15,21H,12,14,17H2,1H3,(H2,29,30,31,32)/b20-15+/t21-/m1/s1 |
| InChIKey | ONKJWEKASNFRRH-LSSXRZCCSA-N |
| XLogP | 4.68 |
| TPSA | 106.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|