About 2-[2-[6-(2-aminophenoxy)hex-1-ynyl]-4-pyridinyl]-1,3-oxazole-4-carboxylic acid
2-[2-[6-(2-aminophenoxy)hex-1-ynyl]-4-pyridinyl]-1,3-oxazole-4-carboxylic acid (PubChem CID 118636155) has the molecular formula C21H19N3O4
and a molecular weight of 377.40 g/mol. Its IUPAC name is 2-[2-[6-(2-aminophenoxy)hex-1-ynyl]-4-pyridinyl]-1,3-oxazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-[2-[6-(2-aminophenoxy)hex-1-ynyl]-4-pyridinyl]-1,3-oxazole-4-carboxylic acid |
| PubChem CID | 118636155 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-[2-[6-(2-aminophenoxy)hex-1-ynyl]-4-pyridinyl]-1,3-oxazole-4-carboxylic acid |
| SMILES | Nc1ccccc1OCCCCC#Cc1cc(-c2nc(C(=O)O)co2)ccn1 |
| InChI | InChI=1S/C21H19N3O4/c22-17-8-4-5-9-19(17)27-12-6-2-1-3-7-16-13-15(10-11-23-16)20-24-18(14-28-20)21(25)26/h4-5,8-11,13-14H,1-2,6,12,22H2,(H,25,26) |
| InChIKey | WNJSGCBVXYILMU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[6-(2-aminophenoxy)hex-1-ynyl]-4-pyridinyl]-1,3-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[6-(2-aminophenoxy)hex-1-ynyl]-4-pyridinyl]-1,3-oxazole-4-carboxylic acid?
The IUPAC name of 2-[2-[6-(2-aminophenoxy)hex-1-ynyl]-4-pyridinyl]-1,3-oxazole-4-carboxylic acid (CID 118636155) is 2-[2-[6-(2-aminophenoxy)hex-1-ynyl]-4-pyridinyl]-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for 2-[2-[6-(2-aminophenoxy)hex-1-ynyl]-4-pyridinyl]-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for 2-[2-[6-(2-aminophenoxy)hex-1-ynyl]-4-pyridinyl]-1,3-oxazole-4-carboxylic acid is Nc1ccccc1OCCCCC#Cc1cc(-c2nc(C(=O)O)co2)ccn1.
What is the InChIKey of 2-[2-[6-(2-aminophenoxy)hex-1-ynyl]-4-pyridinyl]-1,3-oxazole-4-carboxylic acid?
The InChIKey is WNJSGCBVXYILMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O4/c22-17-8-4-5-9-19(17)27-12-6-2-1-3-7-16-13-15(10-11-23-16)20-24-18(14-28-20)21(25)26/h4-5,8-11,13-14H,1-2,6,12,22H2,(H,25,26).
What are the key properties of 2-[2-[6-(2-aminophenoxy)hex-1-ynyl]-4-pyridinyl]-1,3-oxazole-4-carboxylic acid?
2-[2-[6-(2-aminophenoxy)hex-1-ynyl]-4-pyridinyl]-1,3-oxazole-4-carboxylic acid has a molecular weight of 377.40 g/mol, XLogP of 3.62, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[6-(2-aminophenoxy)hex-1-ynyl]-4-pyridinyl]-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 118636155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).