C19H20N4O2S — CID 118636236
14-oxa-3-thia-7,21,22,25-tetrazatetracyclo[19.2.1.12,5.08,13]pentacosa-1(24),2(25),4,8,10,12,22-heptaen-6-one (PubChem CID 118636236) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 14-oxa-3-thia-7,21,22,25-tetrazatetracyclo[19.2.1.12,5.08,13]pentacosa-1(24),2(25),4,8,10,12,22-heptaen-6-one.
| Compound Name | 14-oxa-3-thia-7,21,22,25-tetrazatetracyclo[19.2.1.12,5.08,13]pentacosa-1(24),2(25),4,8,10,12,22-heptaen-6-one |
|---|---|
| PubChem CID | 118636236 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 14-oxa-3-thia-7,21,22,25-tetrazatetracyclo[19.2.1.12,5.08,13]pentacosa-1(24),2(25),4,8,10,12,22-heptaen-6-one |
| SMILES | O=C1Nc2ccccc2OCCCCCCn2cc(cn2)-c2nc1cs2 |
| InChI | InChI=1S/C19H20N4O2S/c24-18-16-13-26-19(22-16)14-11-20-23(12-14)9-5-1-2-6-10-25-17-8-4-3-7-15(17)21-18/h3-4,7-8,11-13H,1-2,5-6,9-10H2,(H,21,24) |
| InChIKey | BDACMZPJNUATHS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |