C18H21N3O3S — CID 118636257
13,18-dioxa-3-thia-7,20,24-triazatetracyclo[17.3.1.12,5.07,11]tetracosa-1(23),2(24),4,19,21-pentaen-6-one (PubChem CID 118636257) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is 13,18-dioxa-3-thia-7,20,24-triazatetracyclo[17.3.1.12,5.07,11]tetracosa-1(23),2(24),4,19,21-pentaen-6-one.
| Compound Name | 13,18-dioxa-3-thia-7,20,24-triazatetracyclo[17.3.1.12,5.07,11]tetracosa-1(23),2(24),4,19,21-pentaen-6-one |
|---|---|
| PubChem CID | 118636257 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 13,18-dioxa-3-thia-7,20,24-triazatetracyclo[17.3.1.12,5.07,11]tetracosa-1(23),2(24),4,19,21-pentaen-6-one |
| SMILES | O=C1c2csc(n2)-c2ccnc(c2)OCCCCOCC2CCCN12 |
| InChI | InChI=1S/C18H21N3O3S/c22-18-15-12-25-17(20-15)13-5-6-19-16(10-13)24-9-2-1-8-23-11-14-4-3-7-21(14)18/h5-6,10,12,14H,1-4,7-9,11H2 |
| InChIKey | RGCKGBGHYFGKIW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |