C22H25N7O3 — CID 118636266
(18E)-10-methyl-3-oxa-7,10,11,14,23,25,29-heptazatetracyclo[22.3.1.12,5.08,12]nonacosa-1(28),2(29),4,8,11,18,24,26-octaene-6,13-dione (PubChem CID 118636266) has the molecular formula C22H25N7O3 and a molecular weight of 435.49 g/mol. Its IUPAC name is (18E)-10-methyl-3-oxa-7,10,11,14,23,25,29-heptazatetracyclo[22.3.1.12,5.08,12]nonacosa-1(28),2(29),4,8,11,18,24,26-octaene-6,13-dione.
| Compound Name | (18E)-10-methyl-3-oxa-7,10,11,14,23,25,29-heptazatetracyclo[22.3.1.12,5.08,12]nonacosa-1(28),2(29),4,8,11,18,24,26-octaene-6,13-dione |
|---|---|
| PubChem CID | 118636266 |
| Molecular Formula | C22H25N7O3 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | (18E)-10-methyl-3-oxa-7,10,11,14,23,25,29-heptazatetracyclo[22.3.1.12,5.08,12]nonacosa-1(28),2(29),4,8,11,18,24,26-octaene-6,13-dione |
| SMILES | Cn1cc2c(n1)C(=O)NCCC/C=C/CCCNc1cc(ccn1)-c1nc(co1)C(=O)N2 |
| InChI | InChI=1S/C22H25N7O3/c1-29-13-16-19(28-29)21(31)25-10-7-5-3-2-4-6-9-23-18-12-15(8-11-24-18)22-27-17(14-32-22)20(30)26-16/h2-3,8,11-14H,4-7,9-10H2,1H3,(H,23,24)(H,25,31)(H,26,30)/b3-2+ |
| InChIKey | GZMKWNYXKBCJNY-NSCUHMNNSA-N |
| XLogP | 2.99 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|