C18H22N4O2S — CID 118636317
13-oxa-3-thia-7,18,20,24-tetrazatetracyclo[17.3.1.12,5.07,11]tetracosa-1(23),2(24),4,19,21-pentaen-6-one (PubChem CID 118636317) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 13-oxa-3-thia-7,18,20,24-tetrazatetracyclo[17.3.1.12,5.07,11]tetracosa-1(23),2(24),4,19,21-pentaen-6-one.
| Compound Name | 13-oxa-3-thia-7,18,20,24-tetrazatetracyclo[17.3.1.12,5.07,11]tetracosa-1(23),2(24),4,19,21-pentaen-6-one |
|---|---|
| PubChem CID | 118636317 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 13-oxa-3-thia-7,18,20,24-tetrazatetracyclo[17.3.1.12,5.07,11]tetracosa-1(23),2(24),4,19,21-pentaen-6-one |
| SMILES | O=C1c2csc(n2)-c2ccnc(c2)NCCCCOCC2CCCN12 |
| InChI | InChI=1S/C18H22N4O2S/c23-18-15-12-25-17(21-15)13-5-7-20-16(10-13)19-6-1-2-9-24-11-14-4-3-8-22(14)18/h5,7,10,12,14H,1-4,6,8-9,11H2,(H,19,20) |
| InChIKey | KDUMEOVTJOAHNR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |