C13H14ClFN2O3 — CID 118636425
(2S)-2-amino-4-[[(E)-3-(3-chloro-2-fluorophenyl)prop-2-enoyl]amino]butanoic acid (PubChem CID 118636425) has the molecular formula C13H14ClFN2O3 and a molecular weight of 300.72 g/mol. Its IUPAC name is (2S)-2-amino-4-[[(E)-3-(3-chloro-2-fluorophenyl)prop-2-enoyl]amino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[[(E)-3-(3-chloro-2-fluorophenyl)prop-2-enoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 118636425 |
| Molecular Formula | C13H14ClFN2O3 |
| Molecular Weight | 300.72 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | (2S)-2-amino-4-[[(E)-3-(3-chloro-2-fluorophenyl)prop-2-enoyl]amino]butanoic acid |
| SMILES | N[C@@H](CCNC(=O)/C=C/c1cccc(Cl)c1F)C(=O)O |
| InChI | InChI=1S/C13H14ClFN2O3/c14-9-3-1-2-8(12(9)15)4-5-11(18)17-7-6-10(16)13(19)20/h1-5,10H,6-7,16H2,(H,17,18)(H,19,20)/b5-4+/t10-/m0/s1 |
| InChIKey | CLCUDRARNSGYPS-YEZKRMTDSA-N |
| XLogP | 1.41 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.72 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|