C19H26N2 — CID 118636759
4,12-ditert-butyl-7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaene (PubChem CID 118636759) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 4,12-ditert-butyl-7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaene.
| Compound Name | 4,12-ditert-butyl-7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaene |
|---|---|
| PubChem CID | 118636759 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 4,12-ditert-butyl-7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaene |
| SMILES | CC(C)(C)C1=CC2=C3C=C(C(C)(C)C)C=CN3CN2C=C1 |
| InChI | InChI=1S/C19H26N2/c1-18(2,3)14-7-9-20-13-21-10-8-15(19(4,5)6)12-17(21)16(20)11-14/h7-12H,13H2,1-6H3 |
| InChIKey | KMWSBXQNCJWACA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |