About [1,3-bis(2-methylpropyl)-2H-imidazol-2-yl]methanediol
[1,3-bis(2-methylpropyl)-2H-imidazol-2-yl]methanediol (PubChem CID 118636762) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is [1,3-bis(2-methylpropyl)-2H-imidazol-2-yl]methanediol.
Molecular Properties
| Compound Name | [1,3-bis(2-methylpropyl)-2H-imidazol-2-yl]methanediol |
| PubChem CID | 118636762 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | [1,3-bis(2-methylpropyl)-2H-imidazol-2-yl]methanediol |
| SMILES | CC(C)CN1C=CN(CC(C)C)C1C(O)O |
| InChI | InChI=1S/C12H24N2O2/c1-9(2)7-13-5-6-14(8-10(3)4)11(13)12(15)16/h5-6,9-12,15-16H,7-8H2,1-4H3 |
| InChIKey | JXSLMGHJNHMCAQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [1,3-bis(2-methylpropyl)-2H-imidazol-2-yl]methanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3-bis(2-methylpropyl)-2H-imidazol-2-yl]methanediol?
The IUPAC name of [1,3-bis(2-methylpropyl)-2H-imidazol-2-yl]methanediol (CID 118636762) is [1,3-bis(2-methylpropyl)-2H-imidazol-2-yl]methanediol.
What is the SMILES notation for [1,3-bis(2-methylpropyl)-2H-imidazol-2-yl]methanediol?
The canonical SMILES for [1,3-bis(2-methylpropyl)-2H-imidazol-2-yl]methanediol is CC(C)CN1C=CN(CC(C)C)C1C(O)O.
What is the InChIKey of [1,3-bis(2-methylpropyl)-2H-imidazol-2-yl]methanediol?
The InChIKey is JXSLMGHJNHMCAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-9(2)7-13-5-6-14(8-10(3)4)11(13)12(15)16/h5-6,9-12,15-16H,7-8H2,1-4H3.
What are the key properties of [1,3-bis(2-methylpropyl)-2H-imidazol-2-yl]methanediol?
[1,3-bis(2-methylpropyl)-2H-imidazol-2-yl]methanediol has a molecular weight of 228.34 g/mol, XLogP of 1.02, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3-bis(2-methylpropyl)-2H-imidazol-2-yl]methanediol is sourced from PubChem (CID 118636762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).