C29H28FNO2 — CID 118637856
4-[2-[5-(4,6-dimethyl-3-pyridinyl)-2-fluorophenyl]-3,4-dihydro-2H-chromen-6-yl]hept-5-yn-2-one (PubChem CID 118637856) has the molecular formula C29H28FNO2 and a molecular weight of 441.55 g/mol. Its IUPAC name is 4-[2-[5-(4,6-dimethyl-3-pyridinyl)-2-fluorophenyl]-3,4-dihydro-2H-chromen-6-yl]hept-5-yn-2-one.
| Compound Name | 4-[2-[5-(4,6-dimethyl-3-pyridinyl)-2-fluorophenyl]-3,4-dihydro-2H-chromen-6-yl]hept-5-yn-2-one |
|---|---|
| PubChem CID | 118637856 |
| Molecular Formula | C29H28FNO2 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 4-[2-[5-(4,6-dimethyl-3-pyridinyl)-2-fluorophenyl]-3,4-dihydro-2H-chromen-6-yl]hept-5-yn-2-one |
| SMILES | CC#CC(CC(C)=O)c1ccc2c(c1)CCC(c1cc(-c3cnc(C)cc3C)ccc1F)O2 |
| InChI | InChI=1S/C29H28FNO2/c1-5-6-21(14-20(4)32)22-8-11-28-24(15-22)9-12-29(33-28)25-16-23(7-10-27(25)30)26-17-31-19(3)13-18(26)2/h7-8,10-11,13,15-17,21,29H,9,12,14H2,1-4H3 |
| InChIKey | YTWFQTPCYLNFCU-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|