C21H23F9O13S4 — CID 118638165
2-(2,2-dimethylbutanoyloxy)ethyl 4-[1,1,2,2,3,3-hexafluoro-3-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonylpropyl]sulfonyloxybenzoate (PubChem CID 118638165) has the molecular formula C21H23F9O13S4 and a molecular weight of 782.65 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxy)ethyl 4-[1,1,2,2,3,3-hexafluoro-3-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonylpropyl]sulfonyloxybenzoate.
| Compound Name | 2-(2,2-dimethylbutanoyloxy)ethyl 4-[1,1,2,2,3,3-hexafluoro-3-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonylpropyl]sulfonyloxybenzoate |
|---|---|
| PubChem CID | 118638165 |
| Molecular Formula | C21H23F9O13S4 |
| Molecular Weight | 782.65 g/mol |
| Exact Mass | 781.99 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxy)ethyl 4-[1,1,2,2,3,3-hexafluoro-3-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonylpropyl]sulfonyloxybenzoate |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)c1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)C(S(C)(=O)=O)S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H23F9O13S4/c1-5-17(2,3)15(32)42-11-10-41-14(31)12-6-8-13(9-7-12)43-47(39,40)20(26,27)18(22,23)19(24,25)45(35,36)16(44(4,33)34)46(37,38)21(28,29)30/h6-9,16H,5,10-11H2,1-4H3 |
| InChIKey | JVKZZYCNVDRJIH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 198.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.65 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|