C21H26F6O9S2 — CID 118638254
4-(2-methylbutanoyloxy)butyl 4-(3-ethylsulfonyl-1,1,2,2,3,3-hexafluoropropyl)sulfonyloxybenzoate (PubChem CID 118638254) has the molecular formula C21H26F6O9S2 and a molecular weight of 600.55 g/mol. Its IUPAC name is 4-(2-methylbutanoyloxy)butyl 4-(3-ethylsulfonyl-1,1,2,2,3,3-hexafluoropropyl)sulfonyloxybenzoate.
| Compound Name | 4-(2-methylbutanoyloxy)butyl 4-(3-ethylsulfonyl-1,1,2,2,3,3-hexafluoropropyl)sulfonyloxybenzoate |
|---|---|
| PubChem CID | 118638254 |
| Molecular Formula | C21H26F6O9S2 |
| Molecular Weight | 600.55 g/mol |
| Exact Mass | 600.09 |
| IUPAC Name | 4-(2-methylbutanoyloxy)butyl 4-(3-ethylsulfonyl-1,1,2,2,3,3-hexafluoropropyl)sulfonyloxybenzoate |
| SMILES | CCC(C)C(=O)OCCCCOC(=O)c1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C21H26F6O9S2/c1-4-14(3)17(28)34-12-6-7-13-35-18(29)15-8-10-16(11-9-15)36-38(32,33)21(26,27)19(22,23)20(24,25)37(30,31)5-2/h8-11,14H,4-7,12-13H2,1-3H3 |
| InChIKey | WSVWTTACNRDXOE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|