C24H32ClN7O3 — CID 118638460
9-butoxy-6-[[2-[(4-chloro-1H-pyrazolo[4,3-c]pyridin-6-yl)amino]ethylamino]methyl]-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione (PubChem CID 118638460) has the molecular formula C24H32ClN7O3 and a molecular weight of 502.02 g/mol. Its IUPAC name is 9-butoxy-6-[[2-[(4-chloro-1H-pyrazolo[4,3-c]pyridin-6-yl)amino]ethylamino]methyl]-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione.
| Compound Name | 9-butoxy-6-[[2-[(4-chloro-1H-pyrazolo[4,3-c]pyridin-6-yl)amino]ethylamino]methyl]-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione |
|---|---|
| PubChem CID | 118638460 |
| Molecular Formula | C24H32ClN7O3 |
| Molecular Weight | 502.02 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 9-butoxy-6-[[2-[(4-chloro-1H-pyrazolo[4,3-c]pyridin-6-yl)amino]ethylamino]methyl]-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione |
| SMILES | CCCCOc1c2n(c(CNCCNc3cc4[nH]ncc4c(Cl)n3)cc1=O)CCN(C(C)C)C2=O |
| InChI | InChI=1S/C24H32ClN7O3/c1-4-5-10-35-22-19(33)11-16(32-9-8-31(15(2)3)24(34)21(22)32)13-26-6-7-27-20-12-18-17(14-28-30-18)23(25)29-20/h11-12,14-15,26H,4-10,13H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | LPNSHNCSELHQJD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.02 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|