C21H25ClN6O3 — CID 118638461
5-[[2-[(4-chloro-1H-pyrazolo[4,3-c]pyridin-6-yl)amino]ethylamino]methyl]-8-hydroxy-2-propan-2-yl-4,4a-dihydro-3H-isoquinoline-1,7-dione (PubChem CID 118638461) has the molecular formula C21H25ClN6O3 and a molecular weight of 444.92 g/mol. Its IUPAC name is 5-[[2-[(4-chloro-1H-pyrazolo[4,3-c]pyridin-6-yl)amino]ethylamino]methyl]-8-hydroxy-2-propan-2-yl-4,4a-dihydro-3H-isoquinoline-1,7-dione.
| Compound Name | 5-[[2-[(4-chloro-1H-pyrazolo[4,3-c]pyridin-6-yl)amino]ethylamino]methyl]-8-hydroxy-2-propan-2-yl-4,4a-dihydro-3H-isoquinoline-1,7-dione |
|---|---|
| PubChem CID | 118638461 |
| Molecular Formula | C21H25ClN6O3 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 5-[[2-[(4-chloro-1H-pyrazolo[4,3-c]pyridin-6-yl)amino]ethylamino]methyl]-8-hydroxy-2-propan-2-yl-4,4a-dihydro-3H-isoquinoline-1,7-dione |
| SMILES | CC(C)N1CCC2C(CNCCNc3cc4[nH]ncc4c(Cl)n3)=CC(=O)C(O)=C2C1=O |
| InChI | InChI=1S/C21H25ClN6O3/c1-11(2)28-6-3-13-12(7-16(29)19(30)18(13)21(28)31)9-23-4-5-24-17-8-15-14(10-25-27-15)20(22)26-17/h7-8,10-11,13,23,30H,3-6,9H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | UTRDBGQSJKYYQF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|