C22H22N6O — CID 118638534
1-[3-(benzylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]-1-[(1R)-1-phenylethyl]urea (PubChem CID 118638534) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is 1-[3-(benzylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]-1-[(1R)-1-phenylethyl]urea.
| Compound Name | 1-[3-(benzylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]-1-[(1R)-1-phenylethyl]urea |
|---|---|
| PubChem CID | 118638534 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 1-[3-(benzylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]-1-[(1R)-1-phenylethyl]urea |
| SMILES | C[C@H](c1ccccc1)N(C(N)=O)c1cc2[nH]nc(NCc3ccccc3)c2cn1 |
| InChI | InChI=1S/C22H22N6O/c1-15(17-10-6-3-7-11-17)28(22(23)29)20-12-19-18(14-24-20)21(27-26-19)25-13-16-8-4-2-5-9-16/h2-12,14-15H,13H2,1H3,(H2,23,29)(H2,25,26,27)/t15-/m1/s1 |
| InChIKey | FKKAHKXMPXFXOP-OAHLLOKOSA-N |
| XLogP | 4.22 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |