C16H24O3 — CID 118638664
2-[(1aR,1bS,2R,5aR,6aR)-1b,2-dimethyl-2,3,5a,6-tetrahydro-1aH-indeno[1,2-b]oxiren-6a-yl]-3-methylidenebutane-1,4-diol (PubChem CID 118638664) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 2-[(1aR,1bS,2R,5aR,6aR)-1b,2-dimethyl-2,3,5a,6-tetrahydro-1aH-indeno[1,2-b]oxiren-6a-yl]-3-methylidenebutane-1,4-diol.
| Compound Name | 2-[(1aR,1bS,2R,5aR,6aR)-1b,2-dimethyl-2,3,5a,6-tetrahydro-1aH-indeno[1,2-b]oxiren-6a-yl]-3-methylidenebutane-1,4-diol |
|---|---|
| PubChem CID | 118638664 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-[(1aR,1bS,2R,5aR,6aR)-1b,2-dimethyl-2,3,5a,6-tetrahydro-1aH-indeno[1,2-b]oxiren-6a-yl]-3-methylidenebutane-1,4-diol |
| SMILES | C=C(CO)C(CO)[C@]12C[C@@H]3C=CC[C@@H](C)[C@]3(C)[C@H]1O2 |
| InChI | InChI=1S/C16H24O3/c1-10(8-17)13(9-18)16-7-12-6-4-5-11(2)15(12,3)14(16)19-16/h4,6,11-14,17-18H,1,5,7-9H2,2-3H3/t11-,12+,13?,14-,15+,16-/m1/s1 |
| InChIKey | AYQOFFMLYVEOEA-KNABHZPTSA-N |
| XLogP | 1.90 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|