C19H22F2N8O3S — CID 118638783
4-[4-[2-(difluoromethyl)benzimidazol-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]piperazine-1-sulfinic acid (PubChem CID 118638783) has the molecular formula C19H22F2N8O3S and a molecular weight of 480.50 g/mol. Its IUPAC name is 4-[4-[2-(difluoromethyl)benzimidazol-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]piperazine-1-sulfinic acid.
| Compound Name | 4-[4-[2-(difluoromethyl)benzimidazol-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]piperazine-1-sulfinic acid |
|---|---|
| PubChem CID | 118638783 |
| Molecular Formula | C19H22F2N8O3S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 4-[4-[2-(difluoromethyl)benzimidazol-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]piperazine-1-sulfinic acid |
| SMILES | O=S(O)N1CCN(c2nc(N3CCOCC3)nc(-n3c(C(F)F)nc4ccccc43)n2)CC1 |
| InChI | InChI=1S/C19H22F2N8O3S/c20-15(21)16-22-13-3-1-2-4-14(13)29(16)19-24-17(26-5-7-28(8-6-26)33(30)31)23-18(25-19)27-9-11-32-12-10-27/h1-4,15H,5-12H2,(H,30,31) |
| InChIKey | OHBOZYOKWXVJBN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|