C23H27N5O3 — CID 118638793
(E)-4-(dimethylamino)-1-[3-[4-(4-hydroxyphenoxy)-2H-pyrazolo[3,4-b]pyridin-3-yl]piperidin-1-yl]but-2-en-1-one (PubChem CID 118638793) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1-[3-[4-(4-hydroxyphenoxy)-2H-pyrazolo[3,4-b]pyridin-3-yl]piperidin-1-yl]but-2-en-1-one.
| Compound Name | (E)-4-(dimethylamino)-1-[3-[4-(4-hydroxyphenoxy)-2H-pyrazolo[3,4-b]pyridin-3-yl]piperidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 118638793 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | (E)-4-(dimethylamino)-1-[3-[4-(4-hydroxyphenoxy)-2H-pyrazolo[3,4-b]pyridin-3-yl]piperidin-1-yl]but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1CCCC(c2[nH]nc3nccc(Oc4ccc(O)cc4)c23)C1 |
| InChI | InChI=1S/C23H27N5O3/c1-27(2)13-4-6-20(30)28-14-3-5-16(15-28)22-21-19(11-12-24-23(21)26-25-22)31-18-9-7-17(29)8-10-18/h4,6-12,16,29H,3,5,13-15H2,1-2H3,(H,24,25,26)/b6-4+ |
| InChIKey | WLYQIVXHXVKSNB-GQCTYLIASA-N |
| XLogP | 3.28 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|