C21H21ClN4O7S — CID 118638958
[(1R,2R,3S,4R)-4-[[5-[5-(2-chlorophenyl)furan-2-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate (PubChem CID 118638958) has the molecular formula C21H21ClN4O7S and a molecular weight of 508.94 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-4-[[5-[5-(2-chlorophenyl)furan-2-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2R,3S,4R)-4-[[5-[5-(2-chlorophenyl)furan-2-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 118638958 |
| Molecular Formula | C21H21ClN4O7S |
| Molecular Weight | 508.94 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | [(1R,2R,3S,4R)-4-[[5-[5-(2-chlorophenyl)furan-2-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1C[C@@H](Nc2ncncc2C(=O)c2ccc(-c3ccccc3Cl)o2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H21ClN4O7S/c22-14-4-2-1-3-12(14)16-5-6-17(33-16)19(28)13-8-24-10-25-21(13)26-15-7-11(18(27)20(15)29)9-32-34(23,30)31/h1-6,8,10-11,15,18,20,27,29H,7,9H2,(H2,23,30,31)(H,24,25,26)/t11-,15-,18-,20+/m1/s1 |
| InChIKey | ZRXJRPCREKSXLD-JGZGQIEPSA-N |
| XLogP | 1.36 |
| TPSA | 177.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.94 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |