C24H26ClN5O6S2 — CID 118639232
[(1R,2S,4R)-4-[[5-[4-(2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridin-8-yl)-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate (PubChem CID 118639232) has the molecular formula C24H26ClN5O6S2 and a molecular weight of 580.09 g/mol. Its IUPAC name is [(1R,2S,4R)-4-[[5-[4-(2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridin-8-yl)-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2S,4R)-4-[[5-[4-(2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridin-8-yl)-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 118639232 |
| Molecular Formula | C24H26ClN5O6S2 |
| Molecular Weight | 580.09 g/mol |
| Exact Mass | 579.10 |
| IUPAC Name | [(1R,2S,4R)-4-[[5-[4-(2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridin-8-yl)-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate |
| SMILES | Cc1sc(C(=O)c2cncnc2N[C@@H]2C[C@H](COS(N)(=O)=O)[C@@H](O)C2)cc1C1OCCc2ccc(Cl)nc21 |
| InChI | InChI=1S/C24H26ClN5O6S2/c1-12-16(23-21-13(4-5-35-23)2-3-20(25)30-21)8-19(37-12)22(32)17-9-27-11-28-24(17)29-15-6-14(18(31)7-15)10-36-38(26,33)34/h2-3,8-9,11,14-15,18,23,31H,4-7,10H2,1H3,(H2,26,33,34)(H,27,28,29)/t14-,15-,18+,23?/m1/s1 |
| InChIKey | QGKYPQQBUWTDAI-HJXBYHIDSA-N |
| XLogP | 2.56 |
| TPSA | 166.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.09 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|