C23H37N8O10PS — CID 118639412
propan-2-yl (2R)-2-[[[(2R,3R)-4-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-2-methoxybutoxy]-[[(4R)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]phosphoryl]amino]propanoate (PubChem CID 118639412) has the molecular formula C23H37N8O10PS and a molecular weight of 648.64 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3R)-4-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-2-methoxybutoxy]-[[(4R)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3R)-4-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-2-methoxybutoxy]-[[(4R)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118639412 |
| Molecular Formula | C23H37N8O10PS |
| Molecular Weight | 648.64 g/mol |
| Exact Mass | 648.21 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3R)-4-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-2-methoxybutoxy]-[[(4R)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]methylsulfanyl]phosphoryl]amino]propanoate |
| SMILES | COc1nc(N)nc2c1ncn2C(O)[C@H](O)[C@@H](COP(=O)(N[C@H](C)C(=O)OC(C)C)SC[C@H]1C(=O)N(C)C(=O)N1C)OC |
| InChI | InChI=1S/C23H37N8O10PS/c1-11(2)41-21(35)12(3)28-42(37,43-9-13-19(33)30(5)23(36)29(13)4)40-8-14(38-6)16(32)20(34)31-10-25-15-17(31)26-22(24)27-18(15)39-7/h10-14,16,20,32,34H,8-9H2,1-7H3,(H,28,37)(H2,24,26,27)/t12-,13+,14-,16-,20?,42?/m1/s1 |
| InChIKey | MFLQXNURZNCYJS-NDFJHLJCSA-N |
| XLogP | -0.04 |
| TPSA | 233.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.64 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|