C23H28N4O4 — CID 118639792
[4-[3-amino-4-(methylaminomethyl)phenyl]phenyl]-[4-(3-hydroxyoxetane-3-carbonyl)piperazin-1-yl]methanone (PubChem CID 118639792) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is [4-[3-amino-4-(methylaminomethyl)phenyl]phenyl]-[4-(3-hydroxyoxetane-3-carbonyl)piperazin-1-yl]methanone.
| Compound Name | [4-[3-amino-4-(methylaminomethyl)phenyl]phenyl]-[4-(3-hydroxyoxetane-3-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 118639792 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | [4-[3-amino-4-(methylaminomethyl)phenyl]phenyl]-[4-(3-hydroxyoxetane-3-carbonyl)piperazin-1-yl]methanone |
| SMILES | CNCc1ccc(-c2ccc(C(=O)N3CCN(C(=O)C4(O)COC4)CC3)cc2)cc1N |
| InChI | InChI=1S/C23H28N4O4/c1-25-13-19-7-6-18(12-20(19)24)16-2-4-17(5-3-16)21(28)26-8-10-27(11-9-26)22(29)23(30)14-31-15-23/h2-7,12,25,30H,8-11,13-15,24H2,1H3 |
| InChIKey | HEWHRVQBVDXOAL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|