About 3-methyl-6-propyl-7H-pyrrolo[2,3-c]pyridazine
3-methyl-6-propyl-7H-pyrrolo[2,3-c]pyridazine (PubChem CID 118640136) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 3-methyl-6-propyl-7H-pyrrolo[2,3-c]pyridazine.
Molecular Properties
| Compound Name | 3-methyl-6-propyl-7H-pyrrolo[2,3-c]pyridazine |
| PubChem CID | 118640136 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 3-methyl-6-propyl-7H-pyrrolo[2,3-c]pyridazine |
| SMILES | CCCc1cc2cc(C)nnc2[nH]1 |
| InChI | InChI=1S/C10H13N3/c1-3-4-9-6-8-5-7(2)12-13-10(8)11-9/h5-6H,3-4H2,1-2H3,(H,11,13) |
| InChIKey | XVKLFRXUIAFKLU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-6-propyl-7H-pyrrolo[2,3-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-propyl-7H-pyrrolo[2,3-c]pyridazine?
The IUPAC name of 3-methyl-6-propyl-7H-pyrrolo[2,3-c]pyridazine (CID 118640136) is 3-methyl-6-propyl-7H-pyrrolo[2,3-c]pyridazine.
What is the SMILES notation for 3-methyl-6-propyl-7H-pyrrolo[2,3-c]pyridazine?
The canonical SMILES for 3-methyl-6-propyl-7H-pyrrolo[2,3-c]pyridazine is CCCc1cc2cc(C)nnc2[nH]1.
What is the InChIKey of 3-methyl-6-propyl-7H-pyrrolo[2,3-c]pyridazine?
The InChIKey is XVKLFRXUIAFKLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-3-4-9-6-8-5-7(2)12-13-10(8)11-9/h5-6H,3-4H2,1-2H3,(H,11,13).
What are the key properties of 3-methyl-6-propyl-7H-pyrrolo[2,3-c]pyridazine?
3-methyl-6-propyl-7H-pyrrolo[2,3-c]pyridazine has a molecular weight of 175.23 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-propyl-7H-pyrrolo[2,3-c]pyridazine is sourced from PubChem (CID 118640136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).