C19H20F3N7O3S — CID 118640260
N-methyl-1-[4-[5-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]triazole-4-carboxamide (PubChem CID 118640260) has the molecular formula C19H20F3N7O3S and a molecular weight of 483.48 g/mol. Its IUPAC name is N-methyl-1-[4-[5-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]triazole-4-carboxamide.
| Compound Name | N-methyl-1-[4-[5-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 118640260 |
| Molecular Formula | C19H20F3N7O3S |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | N-methyl-1-[4-[5-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]triazole-4-carboxamide |
| SMILES | CNC(=O)c1cn(CCCCc2nnc(NC(=O)Cc3cccc(OC(F)(F)F)c3)s2)nn1 |
| InChI | InChI=1S/C19H20F3N7O3S/c1-23-17(31)14-11-29(28-25-14)8-3-2-7-16-26-27-18(33-16)24-15(30)10-12-5-4-6-13(9-12)32-19(20,21)22/h4-6,9,11H,2-3,7-8,10H2,1H3,(H,23,31)(H,24,27,30) |
| InChIKey | NVGMLNMSDALCRF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|