C26H31N7O4S — CID 118641107
10-(oxan-4-yl)-17-propanoyl-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione (PubChem CID 118641107) has the molecular formula C26H31N7O4S and a molecular weight of 537.65 g/mol. Its IUPAC name is 10-(oxan-4-yl)-17-propanoyl-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione.
| Compound Name | 10-(oxan-4-yl)-17-propanoyl-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione |
|---|---|
| PubChem CID | 118641107 |
| Molecular Formula | C26H31N7O4S |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | 10-(oxan-4-yl)-17-propanoyl-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione |
| SMILES | CCC(=O)N1CCCc2cc(ccn2)-c2nc(cs2)C(=O)Nc2cn(C3CCOCC3)nc2C(=O)NCC1 |
| InChI | InChI=1S/C26H31N7O4S/c1-2-22(34)32-10-3-4-18-14-17(5-8-27-18)26-30-21(16-38-26)24(35)29-20-15-33(19-6-12-37-13-7-19)31-23(20)25(36)28-9-11-32/h5,8,14-16,19H,2-4,6-7,9-13H2,1H3,(H,28,36)(H,29,35) |
| InChIKey | VGWPMADNBUOZPF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |