C25H30N8O4S — CID 118641109
2-[10-(oxan-4-yl)-6,13-dioxo-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaen-17-yl]acetamide (PubChem CID 118641109) has the molecular formula C25H30N8O4S and a molecular weight of 538.63 g/mol. Its IUPAC name is 2-[10-(oxan-4-yl)-6,13-dioxo-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaen-17-yl]acetamide.
| Compound Name | 2-[10-(oxan-4-yl)-6,13-dioxo-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaen-17-yl]acetamide |
|---|---|
| PubChem CID | 118641109 |
| Molecular Formula | C25H30N8O4S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 2-[10-(oxan-4-yl)-6,13-dioxo-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaen-17-yl]acetamide |
| SMILES | NC(=O)CN1CCCc2cc(ccn2)-c2nc(cs2)C(=O)Nc2cn(C3CCOCC3)nc2C(=O)NCC1 |
| InChI | InChI=1S/C25H30N8O4S/c26-21(34)14-32-8-1-2-17-12-16(3-6-27-17)25-30-20(15-38-25)23(35)29-19-13-33(18-4-10-37-11-5-18)31-22(19)24(36)28-7-9-32/h3,6,12-13,15,18H,1-2,4-5,7-11,14H2,(H2,26,34)(H,28,36)(H,29,35) |
| InChIKey | LDHGXHVOUPVFQX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 157.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |