C23H25N7O4S — CID 118641161
10-(oxan-4-yl)-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13,16-trione (PubChem CID 118641161) has the molecular formula C23H25N7O4S and a molecular weight of 495.57 g/mol. Its IUPAC name is 10-(oxan-4-yl)-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13,16-trione.
| Compound Name | 10-(oxan-4-yl)-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13,16-trione |
|---|---|
| PubChem CID | 118641161 |
| Molecular Formula | C23H25N7O4S |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 10-(oxan-4-yl)-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13,16-trione |
| SMILES | O=C1CNC(=O)c2nn(C3CCOCC3)cc2NC(=O)c2csc(n2)-c2ccnc(c2)CCCN1 |
| InChI | InChI=1S/C23H25N7O4S/c31-19-11-26-22(33)20-17(12-30(29-20)16-4-8-34-9-5-16)27-21(32)18-13-35-23(28-18)14-3-7-24-15(10-14)2-1-6-25-19/h3,7,10,12-13,16H,1-2,4-6,8-9,11H2,(H,25,31)(H,26,33)(H,27,32) |
| InChIKey | VAKRJUROSGVNEE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 140.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |