C23H26N6O4S — CID 118641177
10-(oxan-4-yl)-17-oxa-3-thia-7,10,11,14,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione (PubChem CID 118641177) has the molecular formula C23H26N6O4S and a molecular weight of 482.57 g/mol. Its IUPAC name is 10-(oxan-4-yl)-17-oxa-3-thia-7,10,11,14,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione.
| Compound Name | 10-(oxan-4-yl)-17-oxa-3-thia-7,10,11,14,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione |
|---|---|
| PubChem CID | 118641177 |
| Molecular Formula | C23H26N6O4S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 10-(oxan-4-yl)-17-oxa-3-thia-7,10,11,14,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione |
| SMILES | O=C1Nc2cn(C3CCOCC3)nc2C(=O)NCCOCCCc2cc(ccn2)-c2nc1cs2 |
| InChI | InChI=1S/C23H26N6O4S/c30-21-19-14-34-23(27-19)15-3-6-24-16(12-15)2-1-8-32-11-7-25-22(31)20-18(26-21)13-29(28-20)17-4-9-33-10-5-17/h3,6,12-14,17H,1-2,4-5,7-11H2,(H,25,31)(H,26,30) |
| InChIKey | KZGLLUROZWHLOJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |