C24H26N6O5 — CID 118641199
11-(oxan-4-yl)-18,21-dioxa-3,8,11,12,15,23-hexazatetracyclo[20.3.1.12,6.09,13]heptacosa-1(26),2,4,6(27),9,12,22,24-octaene-7,14-dione (PubChem CID 118641199) has the molecular formula C24H26N6O5 and a molecular weight of 478.51 g/mol. Its IUPAC name is 11-(oxan-4-yl)-18,21-dioxa-3,8,11,12,15,23-hexazatetracyclo[20.3.1.12,6.09,13]heptacosa-1(26),2,4,6(27),9,12,22,24-octaene-7,14-dione.
| Compound Name | 11-(oxan-4-yl)-18,21-dioxa-3,8,11,12,15,23-hexazatetracyclo[20.3.1.12,6.09,13]heptacosa-1(26),2,4,6(27),9,12,22,24-octaene-7,14-dione |
|---|---|
| PubChem CID | 118641199 |
| Molecular Formula | C24H26N6O5 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 11-(oxan-4-yl)-18,21-dioxa-3,8,11,12,15,23-hexazatetracyclo[20.3.1.12,6.09,13]heptacosa-1(26),2,4,6(27),9,12,22,24-octaene-7,14-dione |
| SMILES | O=C1Nc2cn(C3CCOCC3)nc2C(=O)NCCOCCOc2cc(ccn2)-c2cc1ccn2 |
| InChI | InChI=1S/C24H26N6O5/c31-23-17-2-5-25-19(13-17)16-1-6-26-21(14-16)35-12-11-34-10-7-27-24(32)22-20(28-23)15-30(29-22)18-3-8-33-9-4-18/h1-2,5-6,13-15,18H,3-4,7-12H2,(H,27,32)(H,28,31) |
| InChIKey | ALBFYLZCSOJWOH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |