About 1-[amino(methyl)phosphoryl]oxy-3,5-dimethylbenzene
1-[amino(methyl)phosphoryl]oxy-3,5-dimethylbenzene (PubChem CID 11864137) has the molecular formula C9H14NO2P
and a molecular weight of 199.19 g/mol. Its IUPAC name is 1-[amino(methyl)phosphoryl]oxy-3,5-dimethylbenzene.
Molecular Properties
| Compound Name | 1-[amino(methyl)phosphoryl]oxy-3,5-dimethylbenzene |
| PubChem CID | 11864137 |
| Molecular Formula | C9H14NO2P |
| Molecular Weight | 199.19 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-[amino(methyl)phosphoryl]oxy-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(O[P@@](C)(N)=O)c1 |
| InChI | InChI=1S/C9H14NO2P/c1-7-4-8(2)6-9(5-7)12-13(3,10)11/h4-6H,1-3H3,(H2,10,11)/t13-/m0/s1 |
| InChIKey | CUASNQXPZALNOB-ZDUSSCGKSA-N |
| XLogP | 2.46 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.19 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[amino(methyl)phosphoryl]oxy-3,5-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[amino(methyl)phosphoryl]oxy-3,5-dimethylbenzene?
The IUPAC name of 1-[amino(methyl)phosphoryl]oxy-3,5-dimethylbenzene (CID 11864137) is 1-[amino(methyl)phosphoryl]oxy-3,5-dimethylbenzene.
What is the SMILES notation for 1-[amino(methyl)phosphoryl]oxy-3,5-dimethylbenzene?
The canonical SMILES for 1-[amino(methyl)phosphoryl]oxy-3,5-dimethylbenzene is Cc1cc(C)cc(O[P@@](C)(N)=O)c1.
What is the InChIKey of 1-[amino(methyl)phosphoryl]oxy-3,5-dimethylbenzene?
The InChIKey is CUASNQXPZALNOB-ZDUSSCGKSA-N. The full InChI is InChI=1S/C9H14NO2P/c1-7-4-8(2)6-9(5-7)12-13(3,10)11/h4-6H,1-3H3,(H2,10,11)/t13-/m0/s1.
What are the key properties of 1-[amino(methyl)phosphoryl]oxy-3,5-dimethylbenzene?
1-[amino(methyl)phosphoryl]oxy-3,5-dimethylbenzene has a molecular weight of 199.19 g/mol, XLogP of 2.46, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[amino(methyl)phosphoryl]oxy-3,5-dimethylbenzene is sourced from PubChem (CID 11864137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).