C29H26Cl2FN3O3 — CID 118641398
(3S,3'R,3'aS,7'aS)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-[(3-ethoxyphenyl)methyl]spiro[1H-indole-3,2'-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-c]pyridine]-2,4'-dione (PubChem CID 118641398) has the molecular formula C29H26Cl2FN3O3 and a molecular weight of 554.45 g/mol. Its IUPAC name is (3S,3'R,3'aS,7'aS)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-[(3-ethoxyphenyl)methyl]spiro[1H-indole-3,2'-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-c]pyridine]-2,4'-dione.
| Compound Name | (3S,3'R,3'aS,7'aS)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-[(3-ethoxyphenyl)methyl]spiro[1H-indole-3,2'-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-c]pyridine]-2,4'-dione |
|---|---|
| PubChem CID | 118641398 |
| Molecular Formula | C29H26Cl2FN3O3 |
| Molecular Weight | 554.45 g/mol |
| Exact Mass | 553.13 |
| IUPAC Name | (3S,3'R,3'aS,7'aS)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-[(3-ethoxyphenyl)methyl]spiro[1H-indole-3,2'-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-c]pyridine]-2,4'-dione |
| SMILES | CCOc1cccc(CN2[C@H]3CCNC(=O)[C@H]3[C@H](c3cccc(Cl)c3F)[C@]23C(=O)Nc2cc(Cl)ccc23)c1 |
| InChI | InChI=1S/C29H26Cl2FN3O3/c1-2-38-18-6-3-5-16(13-18)15-35-23-11-12-33-27(36)24(23)25(19-7-4-8-21(31)26(19)32)29(35)20-10-9-17(30)14-22(20)34-28(29)37/h3-10,13-14,23-25H,2,11-12,15H2,1H3,(H,33,36)(H,34,37)/t23-,24+,25-,29+/m0/s1 |
| InChIKey | BJHMTGTXPKRGKQ-APSVEGKFSA-N |
| XLogP | 5.48 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |