C29H27Cl2N3O3 — CID 118641810
(3S,3'R,3'aS,7'aS)-6-chloro-3'-(3-chlorophenyl)-1'-[(3-ethoxyphenyl)methyl]spiro[1H-indole-3,2'-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-c]pyridine]-2,4'-dione (PubChem CID 118641810) has the molecular formula C29H27Cl2N3O3 and a molecular weight of 536.46 g/mol. Its IUPAC name is (3S,3'R,3'aS,7'aS)-6-chloro-3'-(3-chlorophenyl)-1'-[(3-ethoxyphenyl)methyl]spiro[1H-indole-3,2'-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-c]pyridine]-2,4'-dione.
| Compound Name | (3S,3'R,3'aS,7'aS)-6-chloro-3'-(3-chlorophenyl)-1'-[(3-ethoxyphenyl)methyl]spiro[1H-indole-3,2'-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-c]pyridine]-2,4'-dione |
|---|---|
| PubChem CID | 118641810 |
| Molecular Formula | C29H27Cl2N3O3 |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | (3S,3'R,3'aS,7'aS)-6-chloro-3'-(3-chlorophenyl)-1'-[(3-ethoxyphenyl)methyl]spiro[1H-indole-3,2'-3,3a,5,6,7,7a-hexahydropyrrolo[3,2-c]pyridine]-2,4'-dione |
| SMILES | CCOc1cccc(CN2[C@H]3CCNC(=O)[C@H]3[C@H](c3cccc(Cl)c3)[C@]23C(=O)Nc2cc(Cl)ccc23)c1 |
| InChI | InChI=1S/C29H27Cl2N3O3/c1-2-37-21-8-3-5-17(13-21)16-34-24-11-12-32-27(35)25(24)26(18-6-4-7-19(30)14-18)29(34)22-10-9-20(31)15-23(22)33-28(29)36/h3-10,13-15,24-26H,2,11-12,16H2,1H3,(H,32,35)(H,33,36)/t24-,25+,26-,29+/m0/s1 |
| InChIKey | CBQPGXSMFYHCRJ-XWDJFTLGSA-N |
| XLogP | 5.34 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |