C10H16F6N2O5S2 — CID 118641869
3-[4-(dimethylamino)piperidin-1-yl]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 118641869) has the molecular formula C10H16F6N2O5S2 and a molecular weight of 422.37 g/mol. Its IUPAC name is 3-[4-(dimethylamino)piperidin-1-yl]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-[4-(dimethylamino)piperidin-1-yl]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 118641869 |
| Molecular Formula | C10H16F6N2O5S2 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 3-[4-(dimethylamino)piperidin-1-yl]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | CN(C)C1CCN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C10H16F6N2O5S2/c1-17(2)7-3-5-18(6-4-7)24(19,20)9(13,14)8(11,12)10(15,16)25(21,22)23/h7H,3-6H2,1-2H3,(H,21,22,23) |
| InChIKey | APFAAEYITYZLAJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|