About bicyclo[3.1.0]hexa-2,4-diene-1-carboximidamide
bicyclo[3.1.0]hexa-2,4-diene-1-carboximidamide (PubChem CID 118641895) has the molecular formula C7H8N2
and a molecular weight of 120.15 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-2,4-diene-1-carboximidamide.
Molecular Properties
| Compound Name | bicyclo[3.1.0]hexa-2,4-diene-1-carboximidamide |
| PubChem CID | 118641895 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | bicyclo[3.1.0]hexa-2,4-diene-1-carboximidamide |
| SMILES | [H]/N=C(\N)C12C=CC=C1C2 |
| InChI | InChI=1S/C7H8N2/c8-6(9)7-3-1-2-5(7)4-7/h1-3H,4H2,(H3,8,9) |
| InChIKey | QEKBVNHAZGEZHP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[3.1.0]hexa-2,4-diene-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.1.0]hexa-2,4-diene-1-carboximidamide?
The IUPAC name of bicyclo[3.1.0]hexa-2,4-diene-1-carboximidamide (CID 118641895) is bicyclo[3.1.0]hexa-2,4-diene-1-carboximidamide.
What is the SMILES notation for bicyclo[3.1.0]hexa-2,4-diene-1-carboximidamide?
The canonical SMILES for bicyclo[3.1.0]hexa-2,4-diene-1-carboximidamide is [H]/N=C(\N)C12C=CC=C1C2.
What is the InChIKey of bicyclo[3.1.0]hexa-2,4-diene-1-carboximidamide?
The InChIKey is QEKBVNHAZGEZHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2/c8-6(9)7-3-1-2-5(7)4-7/h1-3H,4H2,(H3,8,9).
What are the key properties of bicyclo[3.1.0]hexa-2,4-diene-1-carboximidamide?
bicyclo[3.1.0]hexa-2,4-diene-1-carboximidamide has a molecular weight of 120.15 g/mol, XLogP of 0.81, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.1.0]hexa-2,4-diene-1-carboximidamide is sourced from PubChem (CID 118641895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).