C14H15N3 — CID 118641902
N-[(2E,4Z)-1-amino-2-methylhepta-2,4,6-trienylidene]cyclopenta-1,2,4-triene-1-carboximidamide (PubChem CID 118641902) has the molecular formula C14H15N3 and a molecular weight of 225.30 g/mol. Its IUPAC name is N-[(2E,4Z)-1-amino-2-methylhepta-2,4,6-trienylidene]cyclopenta-1,2,4-triene-1-carboximidamide.
| Compound Name | N-[(2E,4Z)-1-amino-2-methylhepta-2,4,6-trienylidene]cyclopenta-1,2,4-triene-1-carboximidamide |
|---|---|
| PubChem CID | 118641902 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N-[(2E,4Z)-1-amino-2-methylhepta-2,4,6-trienylidene]cyclopenta-1,2,4-triene-1-carboximidamide |
| SMILES | [H]/N=C(/N=C(N)/C(C)=C/C=C\C=C)C1=C=CC=C1 |
| InChI | InChI=1S/C14H15N3/c1-3-4-5-8-11(2)13(15)17-14(16)12-9-6-7-10-12/h3-9H,1H2,2H3,(H3,15,16,17)/b5-4-,11-8+ |
| InChIKey | WXCKUGSAAAIKFQ-LGXSBLIVSA-N |
| XLogP | 2.66 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|