About (2E)-1-[2-(cyclopenta-2,4-dien-1-ylmethyl)hydrazinyl]-2-ethenylpenta-2,4-dien-1-amine
(2E)-1-[2-(cyclopenta-2,4-dien-1-ylmethyl)hydrazinyl]-2-ethenylpenta-2,4-dien-1-amine (PubChem CID 118641927) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is (2E)-1-[2-(cyclopenta-2,4-dien-1-ylmethyl)hydrazinyl]-2-ethenylpenta-2,4-dien-1-amine.
Molecular Properties
| Compound Name | (2E)-1-[2-(cyclopenta-2,4-dien-1-ylmethyl)hydrazinyl]-2-ethenylpenta-2,4-dien-1-amine |
| PubChem CID | 118641927 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (2E)-1-[2-(cyclopenta-2,4-dien-1-ylmethyl)hydrazinyl]-2-ethenylpenta-2,4-dien-1-amine |
| SMILES | C=C/C=C(\C=C)C(N)NNCC1C=CC=C1 |
| InChI | InChI=1S/C13H19N3/c1-3-7-12(4-2)13(14)16-15-10-11-8-5-6-9-11/h3-9,11,13,15-16H,1-2,10,14H2/b12-7+ |
| InChIKey | DNYFPHREQJCUBV-KPKJPENVSA-N |
| XLogP | 1.41 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-1-[2-(cyclopenta-2,4-dien-1-ylmethyl)hydrazinyl]-2-ethenylpenta-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-1-[2-(cyclopenta-2,4-dien-1-ylmethyl)hydrazinyl]-2-ethenylpenta-2,4-dien-1-amine?
The IUPAC name of (2E)-1-[2-(cyclopenta-2,4-dien-1-ylmethyl)hydrazinyl]-2-ethenylpenta-2,4-dien-1-amine (CID 118641927) is (2E)-1-[2-(cyclopenta-2,4-dien-1-ylmethyl)hydrazinyl]-2-ethenylpenta-2,4-dien-1-amine.
What is the SMILES notation for (2E)-1-[2-(cyclopenta-2,4-dien-1-ylmethyl)hydrazinyl]-2-ethenylpenta-2,4-dien-1-amine?
The canonical SMILES for (2E)-1-[2-(cyclopenta-2,4-dien-1-ylmethyl)hydrazinyl]-2-ethenylpenta-2,4-dien-1-amine is C=C/C=C(\C=C)C(N)NNCC1C=CC=C1.
What is the InChIKey of (2E)-1-[2-(cyclopenta-2,4-dien-1-ylmethyl)hydrazinyl]-2-ethenylpenta-2,4-dien-1-amine?
The InChIKey is DNYFPHREQJCUBV-KPKJPENVSA-N. The full InChI is InChI=1S/C13H19N3/c1-3-7-12(4-2)13(14)16-15-10-11-8-5-6-9-11/h3-9,11,13,15-16H,1-2,10,14H2/b12-7+.
What are the key properties of (2E)-1-[2-(cyclopenta-2,4-dien-1-ylmethyl)hydrazinyl]-2-ethenylpenta-2,4-dien-1-amine?
(2E)-1-[2-(cyclopenta-2,4-dien-1-ylmethyl)hydrazinyl]-2-ethenylpenta-2,4-dien-1-amine has a molecular weight of 217.32 g/mol, XLogP of 1.41, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-1-[2-(cyclopenta-2,4-dien-1-ylmethyl)hydrazinyl]-2-ethenylpenta-2,4-dien-1-amine is sourced from PubChem (CID 118641927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).