About 4-(benzenesulfinyl)-2,6-dichloropyridine
4-(benzenesulfinyl)-2,6-dichloropyridine (PubChem CID 118642020) has the molecular formula C11H7Cl2NOS
and a molecular weight of 272.16 g/mol. Its IUPAC name is 4-(benzenesulfinyl)-2,6-dichloropyridine.
Molecular Properties
| Compound Name | 4-(benzenesulfinyl)-2,6-dichloropyridine |
| PubChem CID | 118642020 |
| Molecular Formula | C11H7Cl2NOS |
| Molecular Weight | 272.16 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | 4-(benzenesulfinyl)-2,6-dichloropyridine |
| SMILES | O=S(c1ccccc1)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C11H7Cl2NOS/c12-10-6-9(7-11(13)14-10)16(15)8-4-2-1-3-5-8/h1-7H |
| InChIKey | BMLSUXDJWOUOQD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.16 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-(benzenesulfinyl)-2,6-dichloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzenesulfinyl)-2,6-dichloropyridine?
The IUPAC name of 4-(benzenesulfinyl)-2,6-dichloropyridine (CID 118642020) is 4-(benzenesulfinyl)-2,6-dichloropyridine.
What is the SMILES notation for 4-(benzenesulfinyl)-2,6-dichloropyridine?
The canonical SMILES for 4-(benzenesulfinyl)-2,6-dichloropyridine is O=S(c1ccccc1)c1cc(Cl)nc(Cl)c1.
What is the InChIKey of 4-(benzenesulfinyl)-2,6-dichloropyridine?
The InChIKey is BMLSUXDJWOUOQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7Cl2NOS/c12-10-6-9(7-11(13)14-10)16(15)8-4-2-1-3-5-8/h1-7H.
What are the key properties of 4-(benzenesulfinyl)-2,6-dichloropyridine?
4-(benzenesulfinyl)-2,6-dichloropyridine has a molecular weight of 272.16 g/mol, XLogP of 3.56, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzenesulfinyl)-2,6-dichloropyridine is sourced from PubChem (CID 118642020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).