C20H25FN2O4S — CID 118642025
N-(4-fluoro-3-methylphenyl)-3-[(4-hydroxy-2-methylpentan-2-yl)sulfamoyl]benzamide (PubChem CID 118642025) has the molecular formula C20H25FN2O4S and a molecular weight of 408.50 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-3-[(4-hydroxy-2-methylpentan-2-yl)sulfamoyl]benzamide.
| Compound Name | N-(4-fluoro-3-methylphenyl)-3-[(4-hydroxy-2-methylpentan-2-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 118642025 |
| Molecular Formula | C20H25FN2O4S |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-3-[(4-hydroxy-2-methylpentan-2-yl)sulfamoyl]benzamide |
| SMILES | Cc1cc(NC(=O)c2cccc(S(=O)(=O)NC(C)(C)CC(C)O)c2)ccc1F |
| InChI | InChI=1S/C20H25FN2O4S/c1-13-10-16(8-9-18(13)21)22-19(25)15-6-5-7-17(11-15)28(26,27)23-20(3,4)12-14(2)24/h5-11,14,23-24H,12H2,1-4H3,(H,22,25) |
| InChIKey | COYVJLKZSISCTN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |