C19H22N4O2S2 — CID 118642030
3-[[4-(benzenesulfinyl)-6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]amino]propan-1-ol (PubChem CID 118642030) has the molecular formula C19H22N4O2S2 and a molecular weight of 402.55 g/mol. Its IUPAC name is 3-[[4-(benzenesulfinyl)-6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]amino]propan-1-ol.
| Compound Name | 3-[[4-(benzenesulfinyl)-6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 118642030 |
| Molecular Formula | C19H22N4O2S2 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 3-[[4-(benzenesulfinyl)-6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]amino]propan-1-ol |
| SMILES | Cc1nc(Nc2cc(S(=O)c3ccccc3)cc(NCCCO)n2)sc1C |
| InChI | InChI=1S/C19H22N4O2S2/c1-13-14(2)26-19(21-13)23-18-12-16(11-17(22-18)20-9-6-10-24)27(25)15-7-4-3-5-8-15/h3-5,7-8,11-12,24H,6,9-10H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | PHONIMOBCCQYTF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|