C21H21N3 — CID 118642053
N'-[(2E,4Z)-hepta-2,4,6-trienimidoyl]-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienylidene]cyclopenta-1,3,4-triene-1-carboximidamide (PubChem CID 118642053) has the molecular formula C21H21N3 and a molecular weight of 315.42 g/mol. Its IUPAC name is N'-[(2E,4Z)-hepta-2,4,6-trienimidoyl]-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienylidene]cyclopenta-1,3,4-triene-1-carboximidamide.
| Compound Name | N'-[(2E,4Z)-hepta-2,4,6-trienimidoyl]-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienylidene]cyclopenta-1,3,4-triene-1-carboximidamide |
|---|---|
| PubChem CID | 118642053 |
| Molecular Formula | C21H21N3 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | N'-[(2E,4Z)-hepta-2,4,6-trienimidoyl]-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienylidene]cyclopenta-1,3,4-triene-1-carboximidamide |
| SMILES | [H]/N=C(\C=C\C=C/C=C)/N=C(/N=C/C(/C=C\C)=C/C=C)C1=CC=C=C1 |
| InChI | InChI=1S/C21H21N3/c1-4-7-8-9-16-20(22)24-21(19-14-10-11-15-19)23-17-18(12-5-2)13-6-3/h4-10,12-17,22H,1-2H2,3H3/b8-7-,13-6-,16-9+,18-12+,22-20+,23-17+,24-21+ |
| InChIKey | YOTDYNPDZIMSQG-NAVTXCDUSA-N |
| XLogP | 5.07 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|