About (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide
(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide (PubChem CID 118642057) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide.
Molecular Properties
| Compound Name | (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide |
| PubChem CID | 118642057 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide |
| SMILES | [H]/N=C(N)/C(/C=C\C)=C/C=C |
| InChI | InChI=1S/C8H12N2/c1-3-5-7(6-4-2)8(9)10/h3-6H,1H2,2H3,(H3,9,10)/b6-4-,7-5+ |
| InChIKey | TYWNTWLYFZLMQQ-XGXWUAJZSA-N |
| XLogP | 1.61 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide?
The IUPAC name of (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide (CID 118642057) is (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide.
What is the SMILES notation for (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide?
The canonical SMILES for (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide is [H]/N=C(N)/C(/C=C\C)=C/C=C.
What is the InChIKey of (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide?
The InChIKey is TYWNTWLYFZLMQQ-XGXWUAJZSA-N. The full InChI is InChI=1S/C8H12N2/c1-3-5-7(6-4-2)8(9)10/h3-6H,1H2,2H3,(H3,9,10)/b6-4-,7-5+.
What are the key properties of (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide?
(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide has a molecular weight of 136.20 g/mol, XLogP of 1.61, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide is sourced from PubChem (CID 118642057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).